C27H37N5O9 — CID 164935162
ethyl (1'S,3aR,4S)-6-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-carboxylate (PubChem CID 164935162) has the molecular formula C27H37N5O9 and a molecular weight of 575.62 g/mol. Its IUPAC name is ethyl (1'S,3aR,4S)-6-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-carboxylate.
| Compound Name | ethyl (1'S,3aR,4S)-6-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-carboxylate |
|---|---|
| PubChem CID | 164935162 |
| Molecular Formula | C27H37N5O9 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | ethyl (1'S,3aR,4S)-6-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]12OC(n1cnc3c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ncnc31)C1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C27H37N5O9/c1-10-36-21(33)14-11-27(14)17-16(37-26(8,9)38-17)20(39-27)31-13-30-15-18(31)28-12-29-19(15)32(22(34)40-24(2,3)4)23(35)41-25(5,6)7/h12-14,16-17,20H,10-11H2,1-9H3/t14-,16?,17-,20?,27+/m1/s1 |
| InChIKey | GYLLBCCHDGDPDK-KWZRLYJASA-N |
| XLogP | 3.87 |
| TPSA | 153.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|