C33H17F3N2OPtS — CID 164939696
platinum(2+);15-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-12-(trifluoromethyl)-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene (PubChem CID 164939696) has the molecular formula C33H17F3N2OPtS and a molecular weight of 741.65 g/mol. Its IUPAC name is platinum(2+);15-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-12-(trifluoromethyl)-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene.
| Compound Name | platinum(2+);15-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-12-(trifluoromethyl)-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 164939696 |
| Molecular Formula | C33H17F3N2OPtS |
| Molecular Weight | 741.65 g/mol |
| Exact Mass | 741.07 |
| IUPAC Name | platinum(2+);15-[3-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-2-id-1-yl]-12-(trifluoromethyl)-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16),12,14-octaene |
| SMILES | FC(F)(F)c1cnc(-c2[c-]c(Oc3[c-]c(-c4ccccn4)ccc3)ccc2)c2sc3c4ccccc4ccc3c12.[Pt+2] |
| InChI | InChI=1S/C33H17F3N2OS.Pt/c34-33(35,36)27-19-38-30(32-29(27)26-15-14-20-7-1-2-12-25(20)31(26)40-32)22-9-6-11-24(18-22)39-23-10-5-8-21(17-23)28-13-3-4-16-37-28;/h1-16,19H;/q-2;+2 |
| InChIKey | UPFYGDKUEGMDQD-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.65 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|