C34H41N3O10 — CID 164950405
trans-methyl (4R,5R)-4-[(2S,4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-3-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-hydroxycyclohexane-1-carboxylate (PubChem CID 164950405) has the molecular formula C34H41N3O10 and a molecular weight of 651.71 g/mol. Its IUPAC name is trans-methyl (4R,5R)-4-[(2S,4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-3-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-hydroxycyclohexane-1-carboxylate.
| Compound Name | trans-methyl (4R,5R)-4-[(2S,4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-3-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 164950405 |
| Molecular Formula | C34H41N3O10 |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 651.28 |
| IUPAC Name | trans-methyl (4R,5R)-4-[(2S,4S,5R)-5,6-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-3-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-hydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CC(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)[C@@H](O[C@@H]2OC(C)[C@@H](C)[C@H](OCc3ccccc3)C2OCc2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C34H41N3O10/c1-19-20(2)46-33(30(45-18-22-12-8-5-9-13-22)28(19)44-17-21-10-6-4-7-11-21)47-29-24(14-23(15-26(29)38)32(41)43-3)35-31(40)25-16-27(39)37-34(42)36-25/h4-13,16,19-20,23-24,26,28-30,33,38H,14-15,17-18H2,1-3H3,(H,35,40)(H2,36,37,39,42)/t19-,20?,23?,24?,26-,28+,29-,30?,33+/m1/s1 |
| InChIKey | ALIFVBZKRITKOQ-XYJJRNHJSA-N |
| XLogP | 2.04 |
| TPSA | 178.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |