C16H13ClF2NO2+ — CID 164954763
[2-chloro-5-[3-(3,4-difluorophenyl)-2-oxopropyl]phenyl]-methyl-oxoazanium (PubChem CID 164954763) has the molecular formula C16H13ClF2NO2+ and a molecular weight of 324.73 g/mol. Its IUPAC name is [2-chloro-5-[3-(3,4-difluorophenyl)-2-oxopropyl]phenyl]-methyl-oxoazanium.
| Compound Name | [2-chloro-5-[3-(3,4-difluorophenyl)-2-oxopropyl]phenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 164954763 |
| Molecular Formula | C16H13ClF2NO2+ |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [2-chloro-5-[3-(3,4-difluorophenyl)-2-oxopropyl]phenyl]-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cc(CC(=O)Cc2ccc(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C16H13ClF2NO2/c1-20(22)16-9-11(2-4-13(16)17)7-12(21)6-10-3-5-14(18)15(19)8-10/h2-5,8-9H,6-7H2,1H3/q+1 |
| InChIKey | MPZXLNGQKZIFFK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|