C25H46O11 — CID 164983377
6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylic acid;2,3-ditert-butyl-4,5,6-trihydroxycyclohexane-1-carboxylic acid (PubChem CID 164983377) has the molecular formula C25H46O11 and a molecular weight of 522.63 g/mol. Its IUPAC name is 6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylic acid;2,3-ditert-butyl-4,5,6-trihydroxycyclohexane-1-carboxylic acid.
| Compound Name | 6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylic acid;2,3-ditert-butyl-4,5,6-trihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 164983377 |
| Molecular Formula | C25H46O11 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 6-tert-butyl-3,4,5-trihydroxyoxane-2-carboxylic acid;2,3-ditert-butyl-4,5,6-trihydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)C1C(O)C(O)C(O)C(C(=O)O)C1C(C)(C)C.CC(C)(C)C1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C15H28O5.C10H18O6/c1-14(2,3)8-7(13(19)20)10(16)12(18)11(17)9(8)15(4,5)6;1-10(2,3)8-6(13)4(11)5(12)7(16-8)9(14)15/h7-12,16-18H,1-6H3,(H,19,20);4-8,11-13H,1-3H3,(H,14,15) |
| InChIKey | FUTGCWGDBSNEIM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 205.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |