C24H29NO2 — CID 164988581
(E,3R)-3-(dibenzylamino)dec-6-ene-2,8-dione (PubChem CID 164988581) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (E,3R)-3-(dibenzylamino)dec-6-ene-2,8-dione.
| Compound Name | (E,3R)-3-(dibenzylamino)dec-6-ene-2,8-dione |
|---|---|
| PubChem CID | 164988581 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (E,3R)-3-(dibenzylamino)dec-6-ene-2,8-dione |
| SMILES | CCC(=O)/C=C/CC[C@H](C(C)=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-3-23(27)16-10-11-17-24(20(2)26)25(18-21-12-6-4-7-13-21)19-22-14-8-5-9-15-22/h4-10,12-16,24H,3,11,17-19H2,1-2H3/b16-10+/t24-/m1/s1 |
| InChIKey | XUMKARJUNUOQKR-UEVZPOJISA-N |
| XLogP | 4.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|