C38H30O4 — CID 165004758
(7-ethenyl-9-methylidenefluoren-2-yl) 2-methylprop-2-enoate;(9-methylidenefluoren-2-yl) 2-methylprop-2-enoate (PubChem CID 165004758) has the molecular formula C38H30O4 and a molecular weight of 550.65 g/mol. Its IUPAC name is (7-ethenyl-9-methylidenefluoren-2-yl) 2-methylprop-2-enoate;(9-methylidenefluoren-2-yl) 2-methylprop-2-enoate.
| Compound Name | (7-ethenyl-9-methylidenefluoren-2-yl) 2-methylprop-2-enoate;(9-methylidenefluoren-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 165004758 |
| Molecular Formula | C38H30O4 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | (7-ethenyl-9-methylidenefluoren-2-yl) 2-methylprop-2-enoate;(9-methylidenefluoren-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)C(=C)c1ccccc1-2.C=Cc1ccc2c(c1)C(=C)c1cc(OC(=O)C(=C)C)ccc1-2 |
| InChI | InChI=1S/C20H16O2.C18H14O2/c1-5-14-6-8-16-17-9-7-15(22-20(21)12(2)3)11-19(17)13(4)18(16)10-14;1-11(2)18(19)20-13-8-9-16-15-7-5-4-6-14(15)12(3)17(16)10-13/h5-11H,1-2,4H2,3H3;4-10H,1,3H2,2H3 |
| InChIKey | IUERSRPDZURHFD-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|