About 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane
2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane (PubChem CID 165005192) has the molecular formula C17H20Cl2F2N2O2S
and a molecular weight of 425.33 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane.
Molecular Properties
| Compound Name | 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane |
| PubChem CID | 165005192 |
| Molecular Formula | C17H20Cl2F2N2O2S |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane |
| SMILES | C.C.COc1cc(N)c(Cl)cc1F.COc1cc(SC#N)c(Cl)cc1F |
| InChI | InChI=1S/C8H5ClFNOS.C7H7ClFNO.2CH4/c1-12-7-3-8(13-4-11)5(9)2-6(7)10;1-11-7-3-6(10)4(8)2-5(7)9;;/h2-3H,1H3;2-3H,10H2,1H3;2*1H4 |
| InChIKey | IVVHWHWDYZWCSJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane?
The IUPAC name of 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane (CID 165005192) is 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane.
What is the SMILES notation for 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane?
The canonical SMILES for 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane is C.C.COc1cc(N)c(Cl)cc1F.COc1cc(SC#N)c(Cl)cc1F.
What is the InChIKey of 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane?
The InChIKey is IVVHWHWDYZWCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClFNOS.C7H7ClFNO.2CH4/c1-12-7-3-8(13-4-11)5(9)2-6(7)10;1-11-7-3-6(10)4(8)2-5(7)9;;/h2-3H,1H3;2-3H,10H2,1H3;2*1H4.
What are the key properties of 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane?
2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane has a molecular weight of 425.33 g/mol, XLogP of 6.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-fluoro-5-methoxyaniline;(2-chloro-4-fluoro-5-methoxyphenyl) thiocyanate;methane is sourced from PubChem (CID 165005192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).