C32H33IN6 — CID 165008028
(2S)-1-[3-[(2S)-2,3-dimethyl-1,2-dihydroimidazo[4,5-b]quinolin-1-ium-1-yl]-2,5-dimethylphenyl]-2,3-dimethyl-2H-imidazo[4,5-b]quinoline iodide (PubChem CID 165008028) has the molecular formula C32H33IN6 and a molecular weight of 628.56 g/mol. Its IUPAC name is (2S)-1-[3-[(2S)-2,3-dimethyl-1,2-dihydroimidazo[4,5-b]quinolin-1-ium-1-yl]-2,5-dimethylphenyl]-2,3-dimethyl-2H-imidazo[4,5-b]quinoline iodide.
| Compound Name | (2S)-1-[3-[(2S)-2,3-dimethyl-1,2-dihydroimidazo[4,5-b]quinolin-1-ium-1-yl]-2,5-dimethylphenyl]-2,3-dimethyl-2H-imidazo[4,5-b]quinoline iodide |
|---|---|
| PubChem CID | 165008028 |
| Molecular Formula | C32H33IN6 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | (2S)-1-[3-[(2S)-2,3-dimethyl-1,2-dihydroimidazo[4,5-b]quinolin-1-ium-1-yl]-2,5-dimethylphenyl]-2,3-dimethyl-2H-imidazo[4,5-b]quinoline iodide |
| SMILES | Cc1cc(N2c3cc4ccccc4nc3N(C)[C@H]2C)c(C)c([NH+]2c3cc4ccccc4nc3N(C)[C@@H]2C)c1.[I-] |
| InChI | InChI=1S/C32H32N6.HI/c1-19-15-27(37-21(3)35(5)31-29(37)17-23-11-7-9-13-25(23)33-31)20(2)28(16-19)38-22(4)36(6)32-30(38)18-24-12-8-10-14-26(24)34-32;/h7-18,21-22H,1-6H3;1H/t21-,22+; |
| InChIKey | BSRVYHVLKXVHDU-WHXBIKBMSA-N |
| XLogP | 2.98 |
| TPSA | 39.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|