C30H30N12O2 — CID 165013453
4-(6-aminopurin-9-yl)-1-[4-[[5-[4-(6-aminopurin-9-yl)-2-oxobutyl]-1-methylpyrrol-2-yl]iminomethyl]phenyl]butan-2-one (PubChem CID 165013453) has the molecular formula C30H30N12O2 and a molecular weight of 590.65 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-1-[4-[[5-[4-(6-aminopurin-9-yl)-2-oxobutyl]-1-methylpyrrol-2-yl]iminomethyl]phenyl]butan-2-one.
| Compound Name | 4-(6-aminopurin-9-yl)-1-[4-[[5-[4-(6-aminopurin-9-yl)-2-oxobutyl]-1-methylpyrrol-2-yl]iminomethyl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 165013453 |
| Molecular Formula | C30H30N12O2 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-1-[4-[[5-[4-(6-aminopurin-9-yl)-2-oxobutyl]-1-methylpyrrol-2-yl]iminomethyl]phenyl]butan-2-one |
| SMILES | Cn1c(CC(=O)CCn2cnc3c(N)ncnc32)ccc1N=Cc1ccc(CC(=O)CCn2cnc3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C30H30N12O2/c1-40-21(13-23(44)9-11-42-18-39-26-28(32)35-16-37-30(26)42)6-7-24(40)33-14-20-4-2-19(3-5-20)12-22(43)8-10-41-17-38-25-27(31)34-15-36-29(25)41/h2-7,14-18H,8-13H2,1H3,(H2,31,34,36)(H2,32,35,37) |
| InChIKey | ITLXNTNKUUSCMG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 190.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|