C33H38Cl3N5O6S2 — CID 165018423
[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate;[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2,3,3-trimethylbutanoate;hydrochloride (PubChem CID 165018423) has the molecular formula C33H38Cl3N5O6S2 and a molecular weight of 771.19 g/mol. Its IUPAC name is [2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate;[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2,3,3-trimethylbutanoate;hydrochloride.
| Compound Name | [2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate;[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2,3,3-trimethylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 165018423 |
| Molecular Formula | C33H38Cl3N5O6S2 |
| Molecular Weight | 771.19 g/mol |
| Exact Mass | 769.13 |
| IUPAC Name | [2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2-amino-3,3-dimethylbutanoate;[2-[(5-chloro-1,3-thiazol-2-yl)carbamoyl]phenyl] (2S)-2,3,3-trimethylbutanoate;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)C(=O)Oc1ccccc1C(=O)Nc1ncc(Cl)s1.C[C@H](C(=O)Oc1ccccc1C(=O)Nc1ncc(Cl)s1)C(C)(C)C.Cl |
| InChI | InChI=1S/C17H19ClN2O3S.C16H18ClN3O3S.ClH/c1-10(17(2,3)4)15(22)23-12-8-6-5-7-11(12)14(21)20-16-19-9-13(18)24-16;1-16(2,3)12(18)14(22)23-10-7-5-4-6-9(10)13(21)20-15-19-8-11(17)24-15;/h5-10H,1-4H3,(H,19,20,21);4-8,12H,18H2,1-3H3,(H,19,20,21);1H/t10-;12-;/m11./s1 |
| InChIKey | UZWNLSKUHDCYDX-GOZVBPGLSA-N |
| XLogP | 8.39 |
| TPSA | 162.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.19 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|