C30H45Br2ClN6O10 — CID 165024775
5-bromo-2-chloro-3-nitropyridine;tert-butyl N-[2-[(5-bromo-3-nitro-2-pyridinyl)oxy]ethyl]-N-propan-2-ylcarbamate;tert-butyl N-(2-hydroxyethyl)-N-propan-2-ylcarbamate (PubChem CID 165024775) has the molecular formula C30H45Br2ClN6O10 and a molecular weight of 844.98 g/mol. Its IUPAC name is 5-bromo-2-chloro-3-nitropyridine;tert-butyl N-[2-[(5-bromo-3-nitro-2-pyridinyl)oxy]ethyl]-N-propan-2-ylcarbamate;tert-butyl N-(2-hydroxyethyl)-N-propan-2-ylcarbamate.
| Compound Name | 5-bromo-2-chloro-3-nitropyridine;tert-butyl N-[2-[(5-bromo-3-nitro-2-pyridinyl)oxy]ethyl]-N-propan-2-ylcarbamate;tert-butyl N-(2-hydroxyethyl)-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 165024775 |
| Molecular Formula | C30H45Br2ClN6O10 |
| Molecular Weight | 844.98 g/mol |
| Exact Mass | 842.13 |
| IUPAC Name | 5-bromo-2-chloro-3-nitropyridine;tert-butyl N-[2-[(5-bromo-3-nitro-2-pyridinyl)oxy]ethyl]-N-propan-2-ylcarbamate;tert-butyl N-(2-hydroxyethyl)-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCO)C(=O)OC(C)(C)C.CC(C)N(CCOc1ncc(Br)cc1[N+](=O)[O-])C(=O)OC(C)(C)C.O=[N+]([O-])c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C15H22BrN3O5.C10H21NO3.C5H2BrClN2O2/c1-10(2)18(14(20)24-15(3,4)5)6-7-23-13-12(19(21)22)8-11(16)9-17-13;1-8(2)11(6-7-12)9(13)14-10(3,4)5;6-3-1-4(9(10)11)5(7)8-2-3/h8-10H,6-7H2,1-5H3;8,12H,6-7H2,1-5H3;1-2H |
| InChIKey | LRWZCTTUHADAIJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 200.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.98 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|