C22H26O7 — CID 16503104
[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 4-(2-methylpropoxy)benzoate (PubChem CID 16503104) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 4-(2-methylpropoxy)benzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 16503104 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl] 4-(2-methylpropoxy)benzoate |
| SMILES | COc1cc(C(=O)COC(=O)c2ccc(OCC(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H26O7/c1-14(2)12-28-17-8-6-15(7-9-17)22(24)29-13-18(23)16-10-19(25-3)21(27-5)20(11-16)26-4/h6-11,14H,12-13H2,1-5H3 |
| InChIKey | JIKLXRVBEGCJLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |