C40H36BrN7O3 — CID 165034056
5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 165034056) has the molecular formula C40H36BrN7O3 and a molecular weight of 742.68 g/mol. Its IUPAC name is 5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 165034056 |
| Molecular Formula | C40H36BrN7O3 |
| Molecular Weight | 742.68 g/mol |
| Exact Mass | 741.21 |
| IUPAC Name | 5-benzyl-12-(4-bromo-3-methylbenzoyl)-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | CNc1nn(Cc2ccc(OC)cc2)c2cc(-n3c(=O)c4c(n5ncc(Cc6ccccc6)c35)CN(C(=O)c3ccc(Br)c(C)c3)CC4)ccc12 |
| InChI | InChI=1S/C40H36BrN7O3/c1-25-19-28(11-16-34(25)41)39(49)45-18-17-33-36(24-45)48-38(29(22-43-48)20-26-7-5-4-6-8-26)47(40(33)50)30-12-15-32-35(21-30)46(44-37(32)42-2)23-27-9-13-31(51-3)14-10-27/h4-16,19,21-22H,17-18,20,23-24H2,1-3H3,(H,42,44) |
| InChIKey | FRXKWVJFAKOKKA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |