C33H27BrN6O4 — CID 155655952
4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 155655952) has the molecular formula C33H27BrN6O4 and a molecular weight of 651.52 g/mol. Its IUPAC name is 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155655952 |
| Molecular Formula | C33H27BrN6O4 |
| Molecular Weight | 651.52 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1cc(C(=O)N2CCc3c(n4ncc(Cc5ccc(OC)cc5)c4n(-c4ccc(C(=O)NC)cc4)c3=O)C2)ccc1Br |
| InChI | InChI=1S/C33H27BrN6O4/c1-35-28-17-22(8-13-27(28)34)32(42)38-15-14-26-29(19-38)40-31(23(18-37-40)16-20-4-11-25(44-3)12-5-20)39(33(26)43)24-9-6-21(7-10-24)30(41)36-2/h4-13,17-18H,14-16,19H2,2-3H3,(H,36,41) |
| InChIKey | GKKSVRAVTLWJEY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|