C33H26BrFN6O4 — CID 155655963
4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 155655963) has the molecular formula C33H26BrFN6O4 and a molecular weight of 669.51 g/mol. Its IUPAC name is 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155655963 |
| Molecular Formula | C33H26BrFN6O4 |
| Molecular Weight | 669.51 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1cc(C(=O)N2CCc3c(n4ncc(Cc5ccc(OC)cc5F)c4n(-c4ccc(C(=O)NC)cc4)c3=O)C2)ccc1Br |
| InChI | InChI=1S/C33H26BrFN6O4/c1-36-28-15-21(7-11-26(28)34)32(43)39-13-12-25-29(18-39)41-31(22(17-38-41)14-20-6-10-24(45-3)16-27(20)35)40(33(25)44)23-8-4-19(5-9-23)30(42)37-2/h4-11,15-17H,12-14,18H2,2-3H3,(H,37,42) |
| InChIKey | VMXKAIIONLIVEZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|