C13H15ClN4O3S — CID 165042251
2-methyl-2-[[2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetyl]amino]propanoic acid chloride (PubChem CID 165042251) has the molecular formula C13H15ClN4O3S and a molecular weight of 342.81 g/mol. Its IUPAC name is 2-methyl-2-[[2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetyl]amino]propanoic acid chloride.
| Compound Name | 2-methyl-2-[[2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetyl]amino]propanoic acid chloride |
|---|---|
| PubChem CID | 165042251 |
| Molecular Formula | C13H15ClN4O3S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-methyl-2-[[2-[4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]acetyl]amino]propanoic acid chloride |
| SMILES | CC(C)(NC(=O)C[n+]1ccc(-c2ncns2)cc1)C(=O)O.[Cl-] |
| InChI | InChI=1S/C13H14N4O3S.ClH/c1-13(2,12(19)20)16-10(18)7-17-5-3-9(4-6-17)11-14-8-15-21-11;/h3-6,8H,7H2,1-2H3,(H-,16,18,19,20);1H |
| InChIKey | NXGWHKCTZBVKDV-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|