C24H29ClN4O4 — CID 165072922
(2S,4R,5R)-2-(2-chloro-4-cyclopentyloxyimidazo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolan-2-ol (PubChem CID 165072922) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is (2S,4R,5R)-2-(2-chloro-4-cyclopentyloxyimidazo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolan-2-ol.
| Compound Name | (2S,4R,5R)-2-(2-chloro-4-cyclopentyloxyimidazo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolan-2-ol |
|---|---|
| PubChem CID | 165072922 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | (2S,4R,5R)-2-(2-chloro-4-cyclopentyloxyimidazo[2,1-f][1,2,4]triazin-7-yl)-5-ethyl-4-methyl-3-phenylmethoxyoxolan-2-ol |
| SMILES | CC[C@H]1O[C@@](O)(c2cnc3c(OC4CCCC4)nc(Cl)nn23)C(OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C24H29ClN4O4/c1-3-18-15(2)20(31-14-16-9-5-4-6-10-16)24(30,33-18)19-13-26-21-22(27-23(25)28-29(19)21)32-17-11-7-8-12-17/h4-6,9-10,13,15,17-18,20,30H,3,7-8,11-12,14H2,1-2H3/t15-,18-,20?,24+/m1/s1 |
| InChIKey | XETKLWYYYOQMJJ-WSAZKLFRSA-N |
| XLogP | 4.27 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |