C14H14FNO4 — CID 165078631
2-[4-[(2,6-dioxopiperidin-3-yl)methyl]-2-fluorophenyl]acetic acid (PubChem CID 165078631) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[4-[(2,6-dioxopiperidin-3-yl)methyl]-2-fluorophenyl]acetic acid.
| Compound Name | 2-[4-[(2,6-dioxopiperidin-3-yl)methyl]-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 165078631 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[4-[(2,6-dioxopiperidin-3-yl)methyl]-2-fluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CC2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C14H14FNO4/c15-11-6-8(1-2-9(11)7-13(18)19)5-10-3-4-12(17)16-14(10)20/h1-2,6,10H,3-5,7H2,(H,18,19)(H,16,17,20) |
| InChIKey | XMECQYWQRMIOBX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|