C41H63N5O5 — CID 165092919
[4-[[(3S,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate (PubChem CID 165092919) has the molecular formula C41H63N5O5 and a molecular weight of 705.98 g/mol. Its IUPAC name is [4-[[(3S,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate.
| Compound Name | [4-[[(3S,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate |
|---|---|
| PubChem CID | 165092919 |
| Molecular Formula | C41H63N5O5 |
| Molecular Weight | 705.98 g/mol |
| Exact Mass | 705.48 |
| IUPAC Name | [4-[[(3S,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]methyl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)OCn1ccc2c(C[C@@H]3CN(C(=O)CC#N)CC[C@H]3C)ncnc21)OC(=O)CCCCC |
| InChI | InChI=1S/C41H63N5O5/c1-4-6-8-16-19-35(51-40(49)22-15-7-5-2)20-17-13-11-9-10-12-14-18-21-39(48)50-32-46-28-25-36-37(43-31-44-41(36)46)29-34-30-45(27-24-33(34)3)38(47)23-26-42/h13,17,25,28,31,33-35H,4-12,14-16,18-24,27,29-30,32H2,1-3H3/b17-13-/t33-,34-,35-/m1/s1 |
| InChIKey | MHWXTBJREYGLDZ-AQJBONQRSA-N |
| XLogP | 9.01 |
| TPSA | 127.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.98 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|