C54H96N2O10 — CID 153296907
5-O-[(9Z,33Z)-36-[5-(aminomethoxy)-5-oxopentanoyl]oxy-18,25-dioxodotetraconta-9,33-dien-7-yl] 1-O-(aminomethyl) pentanedioate (PubChem CID 153296907) has the molecular formula C54H96N2O10 and a molecular weight of 933.37 g/mol. Its IUPAC name is 5-O-[(9Z,33Z)-36-[5-(aminomethoxy)-5-oxopentanoyl]oxy-18,25-dioxodotetraconta-9,33-dien-7-yl] 1-O-(aminomethyl) pentanedioate.
| Compound Name | 5-O-[(9Z,33Z)-36-[5-(aminomethoxy)-5-oxopentanoyl]oxy-18,25-dioxodotetraconta-9,33-dien-7-yl] 1-O-(aminomethyl) pentanedioate |
|---|---|
| PubChem CID | 153296907 |
| Molecular Formula | C54H96N2O10 |
| Molecular Weight | 933.37 g/mol |
| Exact Mass | 932.71 |
| IUPAC Name | 5-O-[(9Z,33Z)-36-[5-(aminomethoxy)-5-oxopentanoyl]oxy-18,25-dioxodotetraconta-9,33-dien-7-yl] 1-O-(aminomethyl) pentanedioate |
| SMILES | CCCCCCC(C/C=C\CCCCCCCC(=O)CCCCCCC(=O)CCCCCCC/C=C\CC(CCCCCC)OC(=O)CCCC(=O)OCN)OC(=O)CCCC(=O)OCN |
| InChI | InChI=1S/C54H96N2O10/c1-3-5-7-27-37-49(65-53(61)43-31-41-51(59)63-45-55)39-29-19-15-11-9-13-17-23-33-47(57)35-25-21-22-26-36-48(58)34-24-18-14-10-12-16-20-30-40-50(38-28-8-6-4-2)66-54(62)44-32-42-52(60)64-46-56/h19-20,29-30,49-50H,3-18,21-28,31-46,55-56H2,1-2H3/b29-19-,30-20- |
| InChIKey | GDPWZPZTDBMNOE-NAZWXXJZSA-N |
| XLogP | 12.84 |
| TPSA | 191.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.37 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|