C26H24N2O3S — CID 165098106
(5E)-3-[6-(1H-indol-3-yl)-3-oxohexyl]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 165098106) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is (5E)-3-[6-(1H-indol-3-yl)-3-oxohexyl]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[6-(1H-indol-3-yl)-3-oxohexyl]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 165098106 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (5E)-3-[6-(1H-indol-3-yl)-3-oxohexyl]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)CCN1C(=O)S/C(=C/C=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C26H24N2O3S/c29-21(12-7-11-20-18-27-23-14-5-4-13-22(20)23)16-17-28-25(30)24(32-26(28)31)15-6-10-19-8-2-1-3-9-19/h1-6,8-10,13-15,18,27H,7,11-12,16-17H2/b10-6+,24-15+ |
| InChIKey | XVVXFNJILQFERG-QIMCEDDDSA-N |
| XLogP | 5.74 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|