C25H22N4O3S — CID 10366895
1-[4-(1H-indol-3-yl)butanoyl]-3-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 10366895) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 1-[4-(1H-indol-3-yl)butanoyl]-3-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-[4-(1H-indol-3-yl)butanoyl]-3-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 10366895 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-[4-(1H-indol-3-yl)butanoyl]-3-[(E)-[(E)-3-phenylprop-2-enylidene]amino]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1CC(=O)N(C(=O)CCCc2c[nH]c3ccccc23)C(=S)N1/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H22N4O3S/c30-22(14-6-11-19-17-26-21-13-5-4-12-20(19)21)28-23(31)16-24(32)29(25(28)33)27-15-7-10-18-8-2-1-3-9-18/h1-5,7-10,12-13,15,17,26H,6,11,14,16H2/b10-7+,27-15+ |
| InChIKey | DSLAUZKSDUGVFX-FJOXFRJOSA-N |
| XLogP | 4.06 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|