C29H21N3O — CID 165103704
7-methyl-1-phenyl-2-pyridin-4-yl-6-quinolin-6-yl-8H-indolizin-5-one (PubChem CID 165103704) has the molecular formula C29H21N3O and a molecular weight of 427.51 g/mol. Its IUPAC name is 7-methyl-1-phenyl-2-pyridin-4-yl-6-quinolin-6-yl-8H-indolizin-5-one.
| Compound Name | 7-methyl-1-phenyl-2-pyridin-4-yl-6-quinolin-6-yl-8H-indolizin-5-one |
|---|---|
| PubChem CID | 165103704 |
| Molecular Formula | C29H21N3O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 7-methyl-1-phenyl-2-pyridin-4-yl-6-quinolin-6-yl-8H-indolizin-5-one |
| SMILES | CC1=C(c2ccc3ncccc3c2)C(=O)n2cc(-c3ccncc3)c(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C29H21N3O/c1-19-16-26-28(21-6-3-2-4-7-21)24(20-11-14-30-15-12-20)18-32(26)29(33)27(19)23-9-10-25-22(17-23)8-5-13-31-25/h2-15,17-18H,16H2,1H3 |
| InChIKey | WEUVYTGORPGTNG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |