C29H20ClN3O — CID 148783799
5-(chloromethyl)-2,3-diphenyl-6-quinolin-6-yl-4H-pyrazolo[1,5-a]pyridin-7-one (PubChem CID 148783799) has the molecular formula C29H20ClN3O and a molecular weight of 461.95 g/mol. Its IUPAC name is 5-(chloromethyl)-2,3-diphenyl-6-quinolin-6-yl-4H-pyrazolo[1,5-a]pyridin-7-one.
| Compound Name | 5-(chloromethyl)-2,3-diphenyl-6-quinolin-6-yl-4H-pyrazolo[1,5-a]pyridin-7-one |
|---|---|
| PubChem CID | 148783799 |
| Molecular Formula | C29H20ClN3O |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 5-(chloromethyl)-2,3-diphenyl-6-quinolin-6-yl-4H-pyrazolo[1,5-a]pyridin-7-one |
| SMILES | O=C1C(c2ccc3ncccc3c2)=C(CCl)Cc2c(-c3ccccc3)c(-c3ccccc3)nn21 |
| InChI | InChI=1S/C29H20ClN3O/c30-18-23-17-25-27(19-8-3-1-4-9-19)28(20-10-5-2-6-11-20)32-33(25)29(34)26(23)22-13-14-24-21(16-22)12-7-15-31-24/h1-16H,17-18H2 |
| InChIKey | OKVCOBGVCGJDKK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|