C28H29BrN4O2Si — CID 140853476
3-bromo-5-methyl-2-phenyl-6-quinolin-6-yl-4-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 140853476) has the molecular formula C28H29BrN4O2Si and a molecular weight of 561.56 g/mol. Its IUPAC name is 3-bromo-5-methyl-2-phenyl-6-quinolin-6-yl-4-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 3-bromo-5-methyl-2-phenyl-6-quinolin-6-yl-4-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 140853476 |
| Molecular Formula | C28H29BrN4O2Si |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 3-bromo-5-methyl-2-phenyl-6-quinolin-6-yl-4-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1c(-c2ccc3ncccc3c2)c(=O)n2nc(-c3ccccc3)c(Br)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H29BrN4O2Si/c1-19-24(22-12-13-23-21(17-22)11-8-14-30-23)28(34)33-27(32(19)18-35-15-16-36(2,3)4)25(29)26(31-33)20-9-6-5-7-10-20/h5-14,17H,15-16,18H2,1-4H3 |
| InChIKey | IJXAVBICLGUEBE-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|