C29H23N5O — CID 134347318
4-(2-aminoethyl)-2,3-diphenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 134347318) has the molecular formula C29H23N5O and a molecular weight of 457.54 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2,3-diphenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 4-(2-aminoethyl)-2,3-diphenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 134347318 |
| Molecular Formula | C29H23N5O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-(2-aminoethyl)-2,3-diphenyl-6-quinolin-6-ylpyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | NCCn1cc(-c2ccc3ncccc3c2)c(=O)n2nc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C29H23N5O/c30-15-17-33-19-24(22-13-14-25-23(18-22)12-7-16-31-25)29(35)34-28(33)26(20-8-3-1-4-9-20)27(32-34)21-10-5-2-6-11-21/h1-14,16,18-19H,15,17,30H2 |
| InChIKey | WICMOQIRLYRYKZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |