C23H24F6N4O2 — CID 165124205
[(3aR,6aS)-2-[4-(2-fluoropropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 165124205) has the molecular formula C23H24F6N4O2 and a molecular weight of 502.46 g/mol. Its IUPAC name is [(3aR,6aS)-2-[4-(2-fluoropropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [(3aR,6aS)-2-[4-(2-fluoropropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 165124205 |
| Molecular Formula | C23H24F6N4O2 |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [(3aR,6aS)-2-[4-(2-fluoropropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | Cc1cc(C(C)(C)F)nc(N2C[C@H]3CN(C(=O)c4c(F)cccc4OC(F)(F)C(F)F)C[C@H]3C2)n1 |
| InChI | InChI=1S/C23H24F6N4O2/c1-12-7-17(22(2,3)27)31-21(30-12)33-10-13-8-32(9-14(13)11-33)19(34)18-15(24)5-4-6-16(18)35-23(28,29)20(25)26/h4-7,13-14,20H,8-11H2,1-3H3/t13-,14+ |
| InChIKey | YWLYASCCKUXRLZ-OKILXGFUSA-N |
| XLogP | 4.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|