C13H14BN5O2 — CID 165130507
[4-[[(1-methylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid (PubChem CID 165130507) has the molecular formula C13H14BN5O2 and a molecular weight of 283.10 g/mol. Its IUPAC name is [4-[[(1-methylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[(1-methylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 165130507 |
| Molecular Formula | C13H14BN5O2 |
| Molecular Weight | 283.10 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [4-[[(1-methylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid |
| SMILES | Cn1ncc2ncnc(NCc3ccc(B(O)O)cc3)c21 |
| InChI | InChI=1S/C13H14BN5O2/c1-19-12-11(7-18-19)16-8-17-13(12)15-6-9-2-4-10(5-3-9)14(20)21/h2-5,7-8,20-21H,6H2,1H3,(H,15,16,17) |
| InChIKey | NTWNAIYWCLSOLT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.10 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|