C23H24BN5O2 — CID 165130525
[4-[[(1,5-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid;prop-2-ynylbenzene (PubChem CID 165130525) has the molecular formula C23H24BN5O2 and a molecular weight of 413.29 g/mol. Its IUPAC name is [4-[[(1,5-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid;prop-2-ynylbenzene.
| Compound Name | [4-[[(1,5-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid;prop-2-ynylbenzene |
|---|---|
| PubChem CID | 165130525 |
| Molecular Formula | C23H24BN5O2 |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [4-[[(1,5-dimethylpyrazolo[4,5-d]pyrimidin-7-yl)amino]methyl]phenyl]boronic acid;prop-2-ynylbenzene |
| SMILES | C#CCc1ccccc1.Cc1nc(NCc2ccc(B(O)O)cc2)c2c(cnn2C)n1 |
| InChI | InChI=1S/C14H16BN5O2.C9H8/c1-9-18-12-8-17-20(2)13(12)14(19-9)16-7-10-3-5-11(6-4-10)15(21)22;1-2-6-9-7-4-3-5-8-9/h3-6,8,21-22H,7H2,1-2H3,(H,16,18,19);1,3-5,7-8H,6H2 |
| InChIKey | JZZJBTFJSKXSCR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|