C15H17N5 — CID 39893304
N-benzyl-1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 39893304) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-benzyl-1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-benzyl-1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 39893304 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-benzyl-1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Cc1nc(NCc2ccccc2)c2c(n1)c(C)nn2C |
| InChI | InChI=1S/C15H17N5/c1-10-13-14(20(3)19-10)15(18-11(2)17-13)16-9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3,(H,16,17,18) |
| InChIKey | XUQSQIRVFPHEDW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |