C17H20BN5O4 — CID 165130533
acetaldehyde;[4-[[[7-(methylcarbamoyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid (PubChem CID 165130533) has the molecular formula C17H20BN5O4 and a molecular weight of 369.19 g/mol. Its IUPAC name is acetaldehyde;[4-[[[7-(methylcarbamoyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid.
| Compound Name | acetaldehyde;[4-[[[7-(methylcarbamoyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 165130533 |
| Molecular Formula | C17H20BN5O4 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | acetaldehyde;[4-[[[7-(methylcarbamoyl)-5H-pyrrolo[3,2-d]pyrimidin-4-yl]amino]methyl]phenyl]boronic acid |
| SMILES | CC=O.CNC(=O)c1c[nH]c2c(NCc3ccc(B(O)O)cc3)ncnc12 |
| InChI | InChI=1S/C15H16BN5O3.C2H4O/c1-17-15(22)11-7-18-13-12(11)20-8-21-14(13)19-6-9-2-4-10(5-3-9)16(23)24;1-2-3/h2-5,7-8,18,23-24H,6H2,1H3,(H,17,22)(H,19,20,21);2H,1H3 |
| InChIKey | NEBKBMNXZDCREE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|