C17H22N5O2P — CID 165397879
N-methylformamide;[4-[[(7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]methylphosphinous acid (PubChem CID 165397879) has the molecular formula C17H22N5O2P and a molecular weight of 359.37 g/mol. Its IUPAC name is N-methylformamide;[4-[[(7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]methylphosphinous acid.
| Compound Name | N-methylformamide;[4-[[(7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]methylphosphinous acid |
|---|---|
| PubChem CID | 165397879 |
| Molecular Formula | C17H22N5O2P |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-methylformamide;[4-[[(7-methyl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]methyl]phenyl]methylphosphinous acid |
| SMILES | CNC=O.Cc1c[nH]c2c(NCc3ccc(CPO)cc3)ncnc12 |
| InChI | InChI=1S/C15H17N4OP.C2H5NO/c1-10-6-16-14-13(10)18-9-19-15(14)17-7-11-2-4-12(5-3-11)8-21-20;1-3-2-4/h2-6,9,16,20-21H,7-8H2,1H3,(H,17,18,19);2H,1H3,(H,3,4) |
| InChIKey | ADYQVNPXQRRWEF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|