C9H11N3 — CID 123540887
4-ethyl-7-methyl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 123540887) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 4-ethyl-7-methyl-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 4-ethyl-7-methyl-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 123540887 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-ethyl-7-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | CCc1ncnc2c(C)c[nH]c12 |
| InChI | InChI=1S/C9H11N3/c1-3-7-9-8(12-5-11-7)6(2)4-10-9/h4-5,10H,3H2,1-2H3 |
| InChIKey | OONOBQMYXUTXCU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |