C10H14N4O — CID 123946713
2-[(4-methyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]ethanol (PubChem CID 123946713) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-[(4-methyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]ethanol.
| Compound Name | 2-[(4-methyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 123946713 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-[(4-methyl-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methylamino]ethanol |
| SMILES | Cc1ncnc2c(CNCCO)c[nH]c12 |
| InChI | InChI=1S/C10H14N4O/c1-7-9-10(14-6-13-7)8(5-12-9)4-11-2-3-15/h5-6,11-12,15H,2-4H2,1H3 |
| InChIKey | KTRDHHAPCJWSET-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|