C25H26ClN5O4 — CID 165132809
tert-butyl 4-[6-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]imidazo[1,2-a]pyridin-8-yl]piperazine-1-carboxylate (PubChem CID 165132809) has the molecular formula C25H26ClN5O4 and a molecular weight of 495.97 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]imidazo[1,2-a]pyridin-8-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]imidazo[1,2-a]pyridin-8-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165132809 |
| Molecular Formula | C25H26ClN5O4 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | tert-butyl 4-[6-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]imidazo[1,2-a]pyridin-8-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(Cl)cn3cc(CN4C(=O)c5ccccc5C4=O)nc23)CC1 |
| InChI | InChI=1S/C25H26ClN5O4/c1-25(2,3)35-24(34)29-10-8-28(9-11-29)20-12-16(26)13-30-14-17(27-21(20)30)15-31-22(32)18-6-4-5-7-19(18)23(31)33/h4-7,12-14H,8-11,15H2,1-3H3 |
| InChIKey | ADXRCIQMDRDUMF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|