C24H23Cl2N5O — CID 165154489
3-[1-(2,6-dichloro-3-isocyanophenyl)ethoxy]-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)pyrazin-2-amine (PubChem CID 165154489) has the molecular formula C24H23Cl2N5O and a molecular weight of 468.39 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-isocyanophenyl)ethoxy]-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)pyrazin-2-amine.
| Compound Name | 3-[1-(2,6-dichloro-3-isocyanophenyl)ethoxy]-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 165154489 |
| Molecular Formula | C24H23Cl2N5O |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-isocyanophenyl)ethoxy]-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)pyrazin-2-amine |
| SMILES | [C-]#[N+]c1ccc(Cl)c(C(C)Oc2nc(-c3cc(C)c4c(c3)CN(C)CC4)cnc2N)c1Cl |
| InChI | InChI=1S/C24H23Cl2N5O/c1-13-9-15(10-16-12-31(4)8-7-17(13)16)20-11-29-23(27)24(30-20)32-14(2)21-18(25)5-6-19(28-3)22(21)26/h5-6,9-11,14H,7-8,12H2,1-2,4H3,(H2,27,29) |
| InChIKey | BKJBLISUJZETQI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|