C13H15F3N2O — CID 165157842
N-(3,4-difluorophenyl)-N-ethyl-4-fluoropyrrolidine-2-carboxamide (PubChem CID 165157842) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N-ethyl-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-N-ethyl-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 165157842 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-N-ethyl-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CCN(C(=O)C1CC(F)CN1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F3N2O/c1-2-18(9-3-4-10(15)11(16)6-9)13(19)12-5-8(14)7-17-12/h3-4,6,8,12,17H,2,5,7H2,1H3 |
| InChIKey | SKKZPEYKYFKLEQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |