C20H22N4O4S — CID 16519359
[2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (PubChem CID 16519359) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 16519359 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-ethoxyanilino]-2-oxoethyl] 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCNc1nc(C(=O)OCC(=O)N(CCC#N)c2ccc(OCC)cc2)cs1 |
| InChI | InChI=1S/C20H22N4O4S/c1-3-11-22-20-23-17(14-29-20)19(26)28-13-18(25)24(12-5-10-21)15-6-8-16(9-7-15)27-4-2/h3,6-9,14H,1,4-5,11-13H2,2H3,(H,22,23) |
| InChIKey | WKXYSXMFBLIUBA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|