C9H10Cl3NO2 — CID 165348772
4,4,4-trichloro-2-pyridin-4-ylbutane-1,3-diol (PubChem CID 165348772) has the molecular formula C9H10Cl3NO2 and a molecular weight of 270.54 g/mol. Its IUPAC name is 4,4,4-trichloro-2-pyridin-4-ylbutane-1,3-diol.
| Compound Name | 4,4,4-trichloro-2-pyridin-4-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 165348772 |
| Molecular Formula | C9H10Cl3NO2 |
| Molecular Weight | 270.54 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 4,4,4-trichloro-2-pyridin-4-ylbutane-1,3-diol |
| SMILES | OCC(c1ccncc1)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3NO2/c10-9(11,12)8(15)7(5-14)6-1-3-13-4-2-6/h1-4,7-8,14-15H,5H2 |
| InChIKey | HGMXFEPNGHKEOM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|