C15H18BrN3O2S — CID 165351240
methyl (2S)-2-[(8-amino-4-bromoisoquinolin-1-yl)amino]-4-methylsulfanylbutanoate (PubChem CID 165351240) has the molecular formula C15H18BrN3O2S and a molecular weight of 384.30 g/mol. Its IUPAC name is methyl (2S)-2-[(8-amino-4-bromoisoquinolin-1-yl)amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[(8-amino-4-bromoisoquinolin-1-yl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 165351240 |
| Molecular Formula | C15H18BrN3O2S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | methyl (2S)-2-[(8-amino-4-bromoisoquinolin-1-yl)amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)Nc1ncc(Br)c2cccc(N)c12 |
| InChI | InChI=1S/C15H18BrN3O2S/c1-21-15(20)12(6-7-22-2)19-14-13-9(10(16)8-18-14)4-3-5-11(13)17/h3-5,8,12H,6-7,17H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | LXHYHZHDCWYLGG-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|