C10H9Cl2F2N — CID 165352725
cyclopropyl-(2,5-dichloro-3,6-difluorophenyl)methanamine (PubChem CID 165352725) has the molecular formula C10H9Cl2F2N and a molecular weight of 252.09 g/mol. Its IUPAC name is cyclopropyl-(2,5-dichloro-3,6-difluorophenyl)methanamine.
| Compound Name | cyclopropyl-(2,5-dichloro-3,6-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 165352725 |
| Molecular Formula | C10H9Cl2F2N |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | cyclopropyl-(2,5-dichloro-3,6-difluorophenyl)methanamine |
| SMILES | NC(c1c(F)c(Cl)cc(F)c1Cl)C1CC1 |
| InChI | InChI=1S/C10H9Cl2F2N/c11-5-3-6(13)8(12)7(9(5)14)10(15)4-1-2-4/h3-4,10H,1-2,15H2 |
| InChIKey | YVWCHOOYOLLNRT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|