C15H19Br2NO — CID 165360463
3,5-dibromo-4-(6-methylheptoxy)benzonitrile (PubChem CID 165360463) has the molecular formula C15H19Br2NO and a molecular weight of 389.13 g/mol. Its IUPAC name is 3,5-dibromo-4-(6-methylheptoxy)benzonitrile.
| Compound Name | 3,5-dibromo-4-(6-methylheptoxy)benzonitrile |
|---|---|
| PubChem CID | 165360463 |
| Molecular Formula | C15H19Br2NO |
| Molecular Weight | 389.13 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 3,5-dibromo-4-(6-methylheptoxy)benzonitrile |
| SMILES | CC(C)CCCCCOc1c(Br)cc(C#N)cc1Br |
| InChI | InChI=1S/C15H19Br2NO/c1-11(2)6-4-3-5-7-19-15-13(16)8-12(10-18)9-14(15)17/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | HLSPLHBMMHDJGI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.13 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|