C10H10F13NO3S — CID 165362311
pyrrolidin-1-ium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (PubChem CID 165362311) has the molecular formula C10H10F13NO3S and a molecular weight of 471.24 g/mol. Its IUPAC name is pyrrolidin-1-ium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate.
| Compound Name | pyrrolidin-1-ium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 165362311 |
| Molecular Formula | C10H10F13NO3S |
| Molecular Weight | 471.24 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | pyrrolidin-1-ium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| SMILES | C1CC[NH2+]C1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF13O3S.C4H9N/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22;1-2-4-5-3-1/h(H,20,21,22);5H,1-4H2 |
| InChIKey | QXJXHTNHQMQWLS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|