C25H35NO7S — CID 165366298
4-[3-hydroxy-4-(2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl)butanoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 165366298) has the molecular formula C25H35NO7S and a molecular weight of 493.62 g/mol. Its IUPAC name is 4-[3-hydroxy-4-(2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl)butanoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | 4-[3-hydroxy-4-(2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl)butanoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 165366298 |
| Molecular Formula | C25H35NO7S |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-[3-hydroxy-4-(2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl)butanoyl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)SCC2C(=O)CC(O)CC2CCC(C)C3(O2)OC(C)C(C)O3)cc1 |
| InChI | InChI=1S/C25H35NO7S/c1-15-5-8-21(33-25(15)31-16(2)17(3)32-25)11-19(27)12-23(28)22-14-34-24(29)26(22)13-18-6-9-20(30-4)10-7-18/h6-7,9-10,15-17,19,21-22,27H,5,8,11-14H2,1-4H3 |
| InChIKey | VMLZSSJCDHCOJG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|