C25H31NO5S — CID 67438942
4-[(2R,4R,6R)-4-hydroxy-2-methoxy-6-(2-phenylethyl)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 67438942) has the molecular formula C25H31NO5S and a molecular weight of 457.59 g/mol. Its IUPAC name is 4-[(2R,4R,6R)-4-hydroxy-2-methoxy-6-(2-phenylethyl)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | 4-[(2R,4R,6R)-4-hydroxy-2-methoxy-6-(2-phenylethyl)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 67438942 |
| Molecular Formula | C25H31NO5S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-[(2R,4R,6R)-4-hydroxy-2-methoxy-6-(2-phenylethyl)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)SCC2[C@@]2(OC)C[C@H](O)C[C@@H](CCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C25H31NO5S/c1-29-21-11-9-19(10-12-21)16-26-23(17-32-24(26)28)25(30-2)15-20(27)14-22(31-25)13-8-18-6-4-3-5-7-18/h3-7,9-12,20,22-23,27H,8,13-17H2,1-2H3/t20-,22-,23?,25-/m1/s1 |
| InChIKey | CEVDHFNJDRKEDV-DPMMVGDDSA-N |
| XLogP | 4.25 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|