C27H37NO6S — CID 59644052
(4R)-4-[(1R,8E,13R,15R)-15-methoxy-3-oxo-2,14-dioxabicyclo[11.3.1]heptadec-8-en-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 59644052) has the molecular formula C27H37NO6S and a molecular weight of 503.66 g/mol. Its IUPAC name is (4R)-4-[(1R,8E,13R,15R)-15-methoxy-3-oxo-2,14-dioxabicyclo[11.3.1]heptadec-8-en-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[(1R,8E,13R,15R)-15-methoxy-3-oxo-2,14-dioxabicyclo[11.3.1]heptadec-8-en-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 59644052 |
| Molecular Formula | C27H37NO6S |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (4R)-4-[(1R,8E,13R,15R)-15-methoxy-3-oxo-2,14-dioxabicyclo[11.3.1]heptadec-8-en-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)SC[C@H]2[C@@]2(OC)C[C@H]3C[C@@H](CCC/C=C/CCCCC(=O)O3)O2)cc1 |
| InChI | InChI=1S/C27H37NO6S/c1-31-21-14-12-20(13-15-21)18-28-24(19-35-26(28)30)27(32-2)17-23-16-22(34-27)10-8-6-4-3-5-7-9-11-25(29)33-23/h3-4,12-15,22-24H,5-11,16-19H2,1-2H3/b4-3+/t22-,23-,24+,27-/m1/s1 |
| InChIKey | CPJCVFHQANNDKU-RABLZJMUSA-N |
| XLogP | 5.47 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|