C28H37NO6S — CID 59335228
(4R)-4-[(4Z,8Z,13R,15R)-15-methoxy-5-methyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 59335228) has the molecular formula C28H37NO6S and a molecular weight of 515.67 g/mol. Its IUPAC name is (4R)-4-[(4Z,8Z,13R,15R)-15-methoxy-5-methyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[(4Z,8Z,13R,15R)-15-methoxy-5-methyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 59335228 |
| Molecular Formula | C28H37NO6S |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (4R)-4-[(4Z,8Z,13R,15R)-15-methoxy-5-methyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)SC[C@H]2[C@@]2(OC)CC3C[C@@H](CCC/C=C\CC/C(C)=C\C(=O)O3)O2)cc1 |
| InChI | InChI=1S/C28H37NO6S/c1-20-9-7-5-4-6-8-10-23-16-24(34-26(30)15-20)17-28(33-3,35-23)25-19-36-27(31)29(25)18-21-11-13-22(32-2)14-12-21/h4-5,11-15,23-25H,6-10,16-19H2,1-3H3/b5-4-,20-15-/t23-,24?,25+,28-/m1/s1 |
| InChIKey | PPAPOXGADZAPNR-GNOOBFRDSA-N |
| XLogP | 5.63 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|