C30H39NO6S — CID 91236824
(4R)-4-[(15R,17R)-17-methoxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one (PubChem CID 91236824) has the molecular formula C30H39NO6S and a molecular weight of 541.71 g/mol. Its IUPAC name is (4R)-4-[(15R,17R)-17-methoxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[(15R,17R)-17-methoxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 91236824 |
| Molecular Formula | C30H39NO6S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | (4R)-4-[(15R,17R)-17-methoxy-5-methyl-3-oxo-2,16-dioxabicyclo[13.3.1]nonadeca-4,8,10-trien-17-yl]-3-[(4-methoxyphenyl)methyl]-1,3-thiazolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)SC[C@H]2[C@@]2(OC)CC3C[C@@H](CCCC=CC=CCCC(C)=CC(=O)O3)O2)cc1 |
| InChI | InChI=1S/C30H39NO6S/c1-22-11-9-7-5-4-6-8-10-12-25-18-26(36-28(32)17-22)19-30(35-3,37-25)27-21-38-29(33)31(27)20-23-13-15-24(34-2)16-14-23/h4-7,13-17,25-27H,8-12,18-21H2,1-3H3/t25-,26?,27+,30-/m1/s1 |
| InChIKey | ASWQGBKYUDRAMW-NONRXZNBSA-N |
| XLogP | 6.19 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|