C30H45NO6S — CID 69222548
2-[(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pentyloxan-4-yl]-3-methylhept-2-enoic acid (PubChem CID 69222548) has the molecular formula C30H45NO6S and a molecular weight of 547.76 g/mol. Its IUPAC name is 2-[(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pentyloxan-4-yl]-3-methylhept-2-enoic acid.
| Compound Name | 2-[(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pentyloxan-4-yl]-3-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 69222548 |
| Molecular Formula | C30H45NO6S |
| Molecular Weight | 547.76 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | 2-[(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pentyloxan-4-yl]-3-methylhept-2-enoic acid |
| SMILES | CCCCC[C@@H]1C[C@@H](C(C(=O)O)=C(C)CCCC)C[C@](OC)([C@@H]2CSC(=O)N2Cc2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C30H45NO6S/c1-6-8-10-12-25-17-23(27(28(32)33)21(3)11-9-7-2)18-30(36-5,37-25)26-20-38-29(34)31(26)19-22-13-15-24(35-4)16-14-22/h13-16,23,25-26H,6-12,17-20H2,1-5H3,(H,32,33)/t23-,25-,26+,30-/m1/s1 |
| InChIKey | NNIIGCINZQTKGD-YKEGNUIGSA-N |
| XLogP | 7.04 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|